C21H44N2O — CID 134177721
(3R,4R)-3-methoxy-1-pentadecan-8-ylpiperidin-4-amine (PubChem CID 134177721) has the molecular formula C21H44N2O and a molecular weight of 340.60 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-1-pentadecan-8-ylpiperidin-4-amine.
| Compound Name | (3R,4R)-3-methoxy-1-pentadecan-8-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 134177721 |
| Molecular Formula | C21H44N2O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | (3R,4R)-3-methoxy-1-pentadecan-8-ylpiperidin-4-amine |
| SMILES | CCCCCCCC(CCCCCCC)N1CC[C@@H](N)[C@H](OC)C1 |
| InChI | InChI=1S/C21H44N2O/c1-4-6-8-10-12-14-19(15-13-11-9-7-5-2)23-17-16-20(22)21(18-23)24-3/h19-21H,4-18,22H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | OMDUPKSIPUSUGQ-NHCUHLMSSA-N |
| XLogP | 5.12 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|