C20H42N2 — CID 166754113
(3R)-N,N-dimethyl-1-tetradecan-7-ylpyrrolidin-3-amine (PubChem CID 166754113) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-1-tetradecan-7-ylpyrrolidin-3-amine.
| Compound Name | (3R)-N,N-dimethyl-1-tetradecan-7-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166754113 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | (3R)-N,N-dimethyl-1-tetradecan-7-ylpyrrolidin-3-amine |
| SMILES | CCCCCCCC(CCCCCC)N1CC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C20H42N2/c1-5-7-9-11-13-15-19(14-12-10-8-6-2)22-17-16-20(18-22)21(3)4/h19-20H,5-18H2,1-4H3/t19?,20-/m1/s1 |
| InChIKey | OCEOQCYVGDCHSS-GFOWMXPYSA-N |
| XLogP | 5.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|