C13H15NO — CID 115106309
1-(cyclopropylmethyl)-2,3-dihydroindole-2-carbaldehyde (PubChem CID 115106309) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2,3-dihydroindole-2-carbaldehyde.
| Compound Name | 1-(cyclopropylmethyl)-2,3-dihydroindole-2-carbaldehyde |
|---|---|
| PubChem CID | 115106309 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-2,3-dihydroindole-2-carbaldehyde |
| SMILES | O=CC1Cc2ccccc2N1CC1CC1 |
| InChI | InChI=1S/C13H15NO/c15-9-12-7-11-3-1-2-4-13(11)14(12)8-10-5-6-10/h1-4,9-10,12H,5-8H2 |
| InChIKey | UWBLHSDEGJNSTN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|