C17H23ClN4S — CID 142921386
[(E)-[(2S)-1-[(4-chlorocyclohexyl)methyl]-2,3-dihydroindol-2-yl]methylideneamino]thiourea (PubChem CID 142921386) has the molecular formula C17H23ClN4S and a molecular weight of 350.92 g/mol. Its IUPAC name is [(E)-[(2S)-1-[(4-chlorocyclohexyl)methyl]-2,3-dihydroindol-2-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[(2S)-1-[(4-chlorocyclohexyl)methyl]-2,3-dihydroindol-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 142921386 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [(E)-[(2S)-1-[(4-chlorocyclohexyl)methyl]-2,3-dihydroindol-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/[C@@H]1Cc2ccccc2N1CC1CCC(Cl)CC1 |
| InChI | InChI=1S/C17H23ClN4S/c18-14-7-5-12(6-8-14)11-22-15(10-20-21-17(19)23)9-13-3-1-2-4-16(13)22/h1-4,10,12,14-15H,5-9,11H2,(H3,19,21,23)/b20-10+/t12?,14?,15-/m0/s1 |
| InChIKey | FSXJSJHGVZNMRJ-QAHBSKNOSA-N |
| XLogP | 3.03 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|