C15H22N2 — CID 115106249
[1-(cyclopentylmethyl)-2,3-dihydroindol-2-yl]methanamine (PubChem CID 115106249) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [1-(cyclopentylmethyl)-2,3-dihydroindol-2-yl]methanamine.
| Compound Name | [1-(cyclopentylmethyl)-2,3-dihydroindol-2-yl]methanamine |
|---|---|
| PubChem CID | 115106249 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [1-(cyclopentylmethyl)-2,3-dihydroindol-2-yl]methanamine |
| SMILES | NCC1Cc2ccccc2N1CC1CCCC1 |
| InChI | InChI=1S/C15H22N2/c16-10-14-9-13-7-3-4-8-15(13)17(14)11-12-5-1-2-6-12/h3-4,7-8,12,14H,1-2,5-6,9-11,16H2 |
| InChIKey | XLKXREUEAUBMJY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |