C18H19F3N2O2 — CID 161163508
1-benzyl-3,4-dihydro-2H-quinolin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 161163508) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 1-benzyl-3,4-dihydro-2H-quinolin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-3,4-dihydro-2H-quinolin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161163508 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-benzyl-3,4-dihydro-2H-quinolin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | NC1Cc2ccccc2N(Cc2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18N2.C2HF3O2/c17-15-10-14-8-4-5-9-16(14)18(12-15)11-13-6-2-1-3-7-13;3-2(4,5)1(6)7/h1-9,15H,10-12,17H2;(H,6,7) |
| InChIKey | UQFNMJFVOWVWBH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |