About (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine
(3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine (PubChem CID 56971695) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine.
Molecular Properties
| Compound Name | (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine |
| PubChem CID | 56971695 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine |
| SMILES | N[C@H]1Cc2ccccc2N(O)C1 |
| InChI | InChI=1S/C9H12N2O/c10-8-5-7-3-1-2-4-9(7)11(12)6-8/h1-4,8,12H,5-6,10H2/t8-/m0/s1 |
| InChIKey | KOVJVYABLVJYRF-QMMMGPOBSA-N |
| XLogP | 0.77 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine?
The IUPAC name of (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine (CID 56971695) is (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine.
What is the SMILES notation for (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine?
The canonical SMILES for (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine is N[C@H]1Cc2ccccc2N(O)C1.
What is the InChIKey of (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine?
The InChIKey is KOVJVYABLVJYRF-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H12N2O/c10-8-5-7-3-1-2-4-9(7)11(12)6-8/h1-4,8,12H,5-6,10H2/t8-/m0/s1.
What are the key properties of (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine?
(3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine has a molecular weight of 164.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-hydroxy-3,4-dihydro-2H-quinolin-3-amine is sourced from PubChem (CID 56971695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).