C13H13N3O — CID 133447996
(1S,2R)-1-(pyrazin-2-ylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 133447996) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is (1S,2R)-1-(pyrazin-2-ylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1S,2R)-1-(pyrazin-2-ylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 133447996 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1S,2R)-1-(pyrazin-2-ylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@@H]1Cc2ccccc2[C@@H]1Nc1cnccn1 |
| InChI | InChI=1S/C13H13N3O/c17-11-7-9-3-1-2-4-10(9)13(11)16-12-8-14-5-6-15-12/h1-6,8,11,13,17H,7H2,(H,15,16)/t11-,13+/m1/s1 |
| InChIKey | IFPBJAIRYKQYOV-YPMHNXCESA-N |
| XLogP | 1.55 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |