C13H14N4O — CID 178121485
(1R,2R)-1-[(5-aminopyrimidin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 178121485) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is (1R,2R)-1-[(5-aminopyrimidin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2R)-1-[(5-aminopyrimidin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 178121485 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1R,2R)-1-[(5-aminopyrimidin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | Nc1cncnc1N[C@@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C13H14N4O/c14-10-6-15-7-16-13(10)17-12-9-4-2-1-3-8(9)5-11(12)18/h1-4,6-7,11-12,18H,5,14H2,(H,15,16,17)/t11-,12-/m1/s1 |
| InChIKey | MCULPJWPKFALPU-VXGBXAGGSA-N |
| XLogP | 1.13 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |