C18H17N3O2 — CID 167801808
(1S,2R)-1-[(5-methoxyquinazolin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 167801808) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (1S,2R)-1-[(5-methoxyquinazolin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1S,2R)-1-[(5-methoxyquinazolin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 167801808 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (1S,2R)-1-[(5-methoxyquinazolin-4-yl)amino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | COc1cccc2ncnc(N[C@H]3c4ccccc4C[C@H]3O)c12 |
| InChI | InChI=1S/C18H17N3O2/c1-23-15-8-4-7-13-16(15)18(20-10-19-13)21-17-12-6-3-2-5-11(12)9-14(17)22/h2-8,10,14,17,22H,9H2,1H3,(H,19,20,21)/t14-,17+/m1/s1 |
| InChIKey | ZEQFWKJZSLDFLS-PBHICJAKSA-N |
| XLogP | 2.71 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |