C17H21N3O — CID 59083163
(2S)-1-[(3,6-diethylpyrazin-2-yl)amino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 59083163) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is (2S)-1-[(3,6-diethylpyrazin-2-yl)amino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (2S)-1-[(3,6-diethylpyrazin-2-yl)amino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 59083163 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (2S)-1-[(3,6-diethylpyrazin-2-yl)amino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | CCc1cnc(CC)c(NC2c3ccccc3C[C@@H]2O)n1 |
| InChI | InChI=1S/C17H21N3O/c1-3-12-10-18-14(4-2)17(19-12)20-16-13-8-6-5-7-11(13)9-15(16)21/h5-8,10,15-16,21H,3-4,9H2,1-2H3,(H,19,20)/t15-,16?/m0/s1 |
| InChIKey | CYVKOKRRKFNHNW-VYRBHSGPSA-N |
| XLogP | 2.67 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |