C20H19N7O3 — CID 166217410
1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[phenyl(1H-1,2,4-triazol-5-yl)methyl]urea (PubChem CID 166217410) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[phenyl(1H-1,2,4-triazol-5-yl)methyl]urea.
| Compound Name | 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[phenyl(1H-1,2,4-triazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 166217410 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[phenyl(1H-1,2,4-triazol-5-yl)methyl]urea |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)NC(c1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C20H19N7O3/c28-16-10-21-20(30)27(16)11-13-5-4-8-15(9-13)24-19(29)25-17(18-22-12-23-26-18)14-6-2-1-3-7-14/h1-9,12,17H,10-11H2,(H,21,30)(H,22,23,26)(H2,24,25,29) |
| InChIKey | YQVIYRHNPMLALD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|