C15H21ClN4O3 — CID 119288695
(2S)-2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-methylbutanamide;hydrochloride (PubChem CID 119288695) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-methylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119288695 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S)-2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)Nc1cccc(CN2C(=O)CNC2=O)c1.Cl |
| InChI | InChI=1S/C15H20N4O3.ClH/c1-9(2)13(16)14(21)18-11-5-3-4-10(6-11)8-19-12(20)7-17-15(19)22;/h3-6,9,13H,7-8,16H2,1-2H3,(H,17,22)(H,18,21);1H/t13-;/m0./s1 |
| InChIKey | AUEMNKZUDBYORA-ZOWNYOTGSA-N |
| XLogP | 1.08 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|