C22H21BrN4O — CID 55953512
2-(3-bromo-2-methylindol-1-yl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 55953512) has the molecular formula C22H21BrN4O and a molecular weight of 437.34 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55953512 |
| Molecular Formula | C22H21BrN4O |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)NCc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C22H21BrN4O/c1-16-22(23)19-8-2-3-9-20(19)27(16)15-21(28)24-13-17-6-4-7-18(12-17)14-26-11-5-10-25-26/h2-12H,13-15H2,1H3,(H,24,28) |
| InChIKey | MAWXAQOKTFENRP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |