C16H22N2O4S — CID 119775589
methyl 3-[[3-[(4-hydroxypyrrolidine-2-carbonyl)amino]phenyl]methylsulfanyl]propanoate (PubChem CID 119775589) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl 3-[[3-[(4-hydroxypyrrolidine-2-carbonyl)amino]phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[3-[(4-hydroxypyrrolidine-2-carbonyl)amino]phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 119775589 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl 3-[[3-[(4-hydroxypyrrolidine-2-carbonyl)amino]phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cccc(NC(=O)C2CC(O)CN2)c1 |
| InChI | InChI=1S/C16H22N2O4S/c1-22-15(20)5-6-23-10-11-3-2-4-12(7-11)18-16(21)14-8-13(19)9-17-14/h2-4,7,13-14,17,19H,5-6,8-10H2,1H3,(H,18,21) |
| InChIKey | OUKVSSLVMDSQLA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|