C15H23ClN2O4S — CID 120989091
methyl 3-[[3-[(2-amino-3-methoxypropanoyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride (PubChem CID 120989091) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is methyl 3-[[3-[(2-amino-3-methoxypropanoyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[[3-[(2-amino-3-methoxypropanoyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 120989091 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 3-[[3-[(2-amino-3-methoxypropanoyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
| SMILES | COCC(N)C(=O)Nc1cccc(CSCCC(=O)OC)c1.Cl |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-20-9-13(16)15(19)17-12-5-3-4-11(8-12)10-22-7-6-14(18)21-2;/h3-5,8,13H,6-7,9-10,16H2,1-2H3,(H,17,19);1H |
| InChIKey | YMHMXDNOKHEBSH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|