C19H22N2O3S — CID 120631083
methyl 3-[[3-[(5-amino-2-methylbenzoyl)amino]phenyl]methylsulfanyl]propanoate (PubChem CID 120631083) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is methyl 3-[[3-[(5-amino-2-methylbenzoyl)amino]phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[3-[(5-amino-2-methylbenzoyl)amino]phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 120631083 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 3-[[3-[(5-amino-2-methylbenzoyl)amino]phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cccc(NC(=O)c2cc(N)ccc2C)c1 |
| InChI | InChI=1S/C19H22N2O3S/c1-13-6-7-15(20)11-17(13)19(23)21-16-5-3-4-14(10-16)12-25-9-8-18(22)24-2/h3-7,10-11H,8-9,12,20H2,1-2H3,(H,21,23) |
| InChIKey | NYCWRXZYKXNJAT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|