C18H27ClN2O4S — CID 120931275
methyl 3-[[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]methylsulfanyl]propanoate;hydrochloride (PubChem CID 120931275) has the molecular formula C18H27ClN2O4S and a molecular weight of 402.94 g/mol. Its IUPAC name is methyl 3-[[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]methylsulfanyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 120931275 |
| Molecular Formula | C18H27ClN2O4S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | methyl 3-[[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCSCc1cccc(NC(=O)C2(CN)CCOCC2)c1.Cl |
| InChI | InChI=1S/C18H26N2O4S.ClH/c1-23-16(21)5-10-25-12-14-3-2-4-15(11-14)20-17(22)18(13-19)6-8-24-9-7-18;/h2-4,11H,5-10,12-13,19H2,1H3,(H,20,22);1H |
| InChIKey | NYRUVGBYQFGNHV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|