C20H31ClN2O2S — CID 120933844
4-(aminomethyl)-N-[3-(cyclohexylsulfanylmethyl)phenyl]oxane-4-carboxamide;hydrochloride (PubChem CID 120933844) has the molecular formula C20H31ClN2O2S and a molecular weight of 399.00 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(cyclohexylsulfanylmethyl)phenyl]oxane-4-carboxamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[3-(cyclohexylsulfanylmethyl)phenyl]oxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120933844 |
| Molecular Formula | C20H31ClN2O2S |
| Molecular Weight | 399.00 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(cyclohexylsulfanylmethyl)phenyl]oxane-4-carboxamide;hydrochloride |
| SMILES | Cl.NCC1(C(=O)Nc2cccc(CSC3CCCCC3)c2)CCOCC1 |
| InChI | InChI=1S/C20H30N2O2S.ClH/c21-15-20(9-11-24-12-10-20)19(23)22-17-6-4-5-16(13-17)14-25-18-7-2-1-3-8-18;/h4-6,13,18H,1-3,7-12,14-15,21H2,(H,22,23);1H |
| InChIKey | QWBXKHWJZHNBJL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.00 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |