C21H22N2O4S — CID 120526366
3-[[3-[(1-methyl-2-oxo-3,4-dihydroquinoline-6-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 120526366) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[[3-[(1-methyl-2-oxo-3,4-dihydroquinoline-6-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[(1-methyl-2-oxo-3,4-dihydroquinoline-6-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 120526366 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[[3-[(1-methyl-2-oxo-3,4-dihydroquinoline-6-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | CN1C(=O)CCc2cc(C(=O)Nc3cccc(CSCCC(=O)O)c3)ccc21 |
| InChI | InChI=1S/C21H22N2O4S/c1-23-18-7-5-16(12-15(18)6-8-19(23)24)21(27)22-17-4-2-3-14(11-17)13-28-10-9-20(25)26/h2-5,7,11-12H,6,8-10,13H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | QPWUSNWNYNXOAW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|