C17H20N2O4S2 — CID 120526334
3-[[3-[[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 120526334) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[[3-[[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 120526334 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-[[3-[[2-(methoxymethyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | COCc1nc(C)c(C(=O)Nc2cccc(CSCCC(=O)O)c2)s1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-11-16(25-14(18-11)9-23-2)17(22)19-13-5-3-4-12(8-13)10-24-7-6-15(20)21/h3-5,8H,6-7,9-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | GMLSYDULAJXWNJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|