C26H20ClN5O4S — CID 143201750
2-chloro-N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-6-methoxypyridine-4-carboxamide (PubChem CID 143201750) has the molecular formula C26H20ClN5O4S and a molecular weight of 534.00 g/mol. Its IUPAC name is 2-chloro-N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-6-methoxypyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-6-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 143201750 |
| Molecular Formula | C26H20ClN5O4S |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 2-chloro-N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-6-methoxypyridine-4-carboxamide |
| SMILES | COc1cccc(-c2nc(SCc3cccc(NC(=O)c4cc(Cl)nc(OC)c4)c3)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C26H20ClN5O4S/c1-35-19-8-4-6-16(10-19)23-20(13-28)25(34)32-26(31-23)37-14-15-5-3-7-18(9-15)29-24(33)17-11-21(27)30-22(12-17)36-2/h3-12H,14H2,1-2H3,(H,29,33)(H,31,32,34) |
| InChIKey | APASWXXJPXSQDR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|