C20H17N7O2S — CID 176980247
3-[2-[(2Z)-2-amino-2-hydrazinylideneethyl]sulfanyl-5-cyano-6-oxo-1H-pyrimidin-4-yl]-N-phenylbenzamide (PubChem CID 176980247) has the molecular formula C20H17N7O2S and a molecular weight of 419.47 g/mol. Its IUPAC name is 3-[2-[(2Z)-2-amino-2-hydrazinylideneethyl]sulfanyl-5-cyano-6-oxo-1H-pyrimidin-4-yl]-N-phenylbenzamide.
| Compound Name | 3-[2-[(2Z)-2-amino-2-hydrazinylideneethyl]sulfanyl-5-cyano-6-oxo-1H-pyrimidin-4-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 176980247 |
| Molecular Formula | C20H17N7O2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[2-[(2Z)-2-amino-2-hydrazinylideneethyl]sulfanyl-5-cyano-6-oxo-1H-pyrimidin-4-yl]-N-phenylbenzamide |
| SMILES | N#Cc1c(-c2cccc(C(=O)Nc3ccccc3)c2)nc(SC/C(N)=N/N)[nH]c1=O |
| InChI | InChI=1S/C20H17N7O2S/c21-10-15-17(25-20(26-19(15)29)30-11-16(22)27-23)12-5-4-6-13(9-12)18(28)24-14-7-2-1-3-8-14/h1-9H,11,23H2,(H2,22,27)(H,24,28)(H,25,26,29) |
| InChIKey | GMPNWTNMXSPIEZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 163.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|