C33H21Cl2N5O2S — CID 143201731
3,4-dichloro-N-[3-[[5-cyano-4-(3-indol-1-ylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]benzamide (PubChem CID 143201731) has the molecular formula C33H21Cl2N5O2S and a molecular weight of 622.54 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[[5-cyano-4-(3-indol-1-ylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[[5-cyano-4-(3-indol-1-ylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 143201731 |
| Molecular Formula | C33H21Cl2N5O2S |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | 3,4-dichloro-N-[3-[[5-cyano-4-(3-indol-1-ylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]benzamide |
| SMILES | N#Cc1c(-c2cccc(-n3ccc4ccccc43)c2)nc(SCc2cccc(NC(=O)c3ccc(Cl)c(Cl)c3)c2)[nH]c1=O |
| InChI | InChI=1S/C33H21Cl2N5O2S/c34-27-12-11-23(17-28(27)35)31(41)37-24-8-3-5-20(15-24)19-43-33-38-30(26(18-36)32(42)39-33)22-7-4-9-25(16-22)40-14-13-21-6-1-2-10-29(21)40/h1-17H,19H2,(H,37,41)(H,38,39,42) |
| InChIKey | ONNAPZZEULXCQL-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|