C22H19N5O5S — CID 135937467
(2S)-2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide (PubChem CID 135937467) has the molecular formula C22H19N5O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is (2S)-2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide.
| Compound Name | (2S)-2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 135937467 |
| Molecular Formula | C22H19N5O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (2S)-2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide |
| SMILES | CC[C@H](Sc1nc(-c2ccc(OC)cc2)c(C#N)c(=O)[nH]1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H19N5O5S/c1-3-18(21(29)24-14-6-8-15(9-7-14)27(30)31)33-22-25-19(17(12-23)20(28)26-22)13-4-10-16(32-2)11-5-13/h4-11,18H,3H2,1-2H3,(H,24,29)(H,25,26,28)/t18-/m0/s1 |
| InChIKey | AMTJNTDHRUIARZ-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|