C23H22N6O4S — CID 135937465
(2S)-2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide (PubChem CID 135937465) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is (2S)-2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide.
| Compound Name | (2S)-2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 135937465 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (2S)-2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)butanamide |
| SMILES | CC[C@H](Sc1nc(-c2ccc(N(C)C)cc2)c(C#N)c(=O)[nH]1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N6O4S/c1-4-19(22(31)25-15-7-11-17(12-8-15)29(32)33)34-23-26-20(18(13-24)21(30)27-23)14-5-9-16(10-6-14)28(2)3/h5-12,19H,4H2,1-3H3,(H,25,31)(H,26,27,30)/t19-/m0/s1 |
| InChIKey | SMQVITHOHWDMSF-IBGZPJMESA-N |
| XLogP | 3.79 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|