C16H21N3O2S — CID 136686194
2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]-N,N-dipropylacetamide (PubChem CID 136686194) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]-N,N-dipropylacetamide.
| Compound Name | 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 136686194 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CSc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-9-19(10-4-2)14(20)11-22-16-17-13-8-6-5-7-12(13)15(21)18-16/h5-8H,3-4,9-11H2,1-2H3,(H,17,18,21) |
| InChIKey | IPTGZQXZDWGUGX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |