C20H21N6O3S+ — CID 135972504
2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(1,5-dimethyl-3-oxo-2-phenyl-4H-pyrazol-1-ium-4-yl)acetamide (PubChem CID 135972504) has the molecular formula C20H21N6O3S+ and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(1,5-dimethyl-3-oxo-2-phenyl-4H-pyrazol-1-ium-4-yl)acetamide.
| Compound Name | 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(1,5-dimethyl-3-oxo-2-phenyl-4H-pyrazol-1-ium-4-yl)acetamide |
|---|---|
| PubChem CID | 135972504 |
| Molecular Formula | C20H21N6O3S+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(1,5-dimethyl-3-oxo-2-phenyl-4H-pyrazol-1-ium-4-yl)acetamide |
| SMILES | CCc1nc(SCC(=O)NC2C(=O)N(c3ccccc3)[N+](C)=C2C)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C20H20N6O3S/c1-4-15-14(10-21)18(28)24-20(22-15)30-11-16(27)23-17-12(2)25(3)26(19(17)29)13-8-6-5-7-9-13/h5-9,17H,4,11H2,1-3H3,(H-,22,23,24,27,28)/p+1 |
| InChIKey | ZSMWCSBNRIYUPB-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|