C15H16N4O3S — CID 135996140
2-[[2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 135996140) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-[[2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 135996140 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[[2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | CCc1cc(=O)[nH]c(SCC(=O)Nc2ccccc2C(N)=O)n1 |
| InChI | InChI=1S/C15H16N4O3S/c1-2-9-7-12(20)19-15(17-9)23-8-13(21)18-11-6-4-3-5-10(11)14(16)22/h3-7H,2,8H2,1H3,(H2,16,22)(H,18,21)(H,17,19,20) |
| InChIKey | CNTCVAGMRARBFJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |