C19H25N3O2S — CID 135574667
N-[2-[(2S)-butan-2-yl]phenyl]-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 135574667) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[2-[(2S)-butan-2-yl]phenyl]-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135574667 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)Nc2ccccc2[C@@H](C)CC)n1 |
| InChI | InChI=1S/C19H25N3O2S/c1-4-8-14-11-17(23)22-19(20-14)25-12-18(24)21-16-10-7-6-9-15(16)13(3)5-2/h6-7,9-11,13H,4-5,8,12H2,1-3H3,(H,21,24)(H,20,22,23)/t13-/m0/s1 |
| InChIKey | XWLICLCFVSLMCL-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |