C12H11N5O3S — CID 135996863
2-[[2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 135996863) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-[[2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 135996863 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[[2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CSc1nncc(=O)[nH]1 |
| InChI | InChI=1S/C12H11N5O3S/c13-11(20)7-3-1-2-4-8(7)15-10(19)6-21-12-16-9(18)5-14-17-12/h1-5H,6H2,(H2,13,20)(H,15,19)(H,16,17,18) |
| InChIKey | SMYSTJKLUGDBBD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |