C5H4N3O3S- — CID 135784426
2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate (PubChem CID 135784426) has the molecular formula C5H4N3O3S- and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate.
| Compound Name | 2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135784426 |
| Molecular Formula | C5H4N3O3S- |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nncc(=O)[nH]1 |
| InChI | InChI=1S/C5H5N3O3S/c9-3-1-6-8-5(7-3)12-2-4(10)11/h1H,2H2,(H,10,11)(H,7,8,9)/p-1 |
| InChIKey | JUYHRDUSOVNGBQ-UHFFFAOYSA-M |
| XLogP | -1.99 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |