C12H12N4O2S — CID 135445462
N-benzyl-2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide (PubChem CID 135445462) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-benzyl-2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135445462 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-benzyl-2-[(5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncc(=O)[nH]1)NCc1ccccc1 |
| InChI | InChI=1S/C12H12N4O2S/c17-10-7-14-16-12(15-10)19-8-11(18)13-6-9-4-2-1-3-5-9/h1-5,7H,6,8H2,(H,13,18)(H,15,16,17) |
| InChIKey | PEIUFXOOFCYYME-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |