C16H17N3O4S — CID 136684396
N-(2-acetylphenyl)-2-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 136684396) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 136684396 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(2-acetylphenyl)-2-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | COCc1cc(=O)[nH]c(SCC(=O)Nc2ccccc2C(C)=O)n1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10(20)12-5-3-4-6-13(12)18-15(22)9-24-16-17-11(8-23-2)7-14(21)19-16/h3-7H,8-9H2,1-2H3,(H,18,22)(H,17,19,21) |
| InChIKey | BPNAMSODPYDRPP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |