C19H23N3O4S — CID 136685129
ethyl 2-[[2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 136685129) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 136685129 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 2-[[2-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCc1cc(=O)[nH]c(SCC(=O)Nc2ccccc2C(=O)OCC)n1 |
| InChI | InChI=1S/C19H23N3O4S/c1-3-5-8-13-11-16(23)22-19(20-13)27-12-17(24)21-15-10-7-6-9-14(15)18(25)26-4-2/h6-7,9-11H,3-5,8,12H2,1-2H3,(H,21,24)(H,20,22,23) |
| InChIKey | JUMDUZMTZRYIPF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |