C18H21N3O4S2 — CID 17355957
2-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 17355957) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17355957 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | COCCOc1ccccc1C(=O)NC(=S)Nc1sc(C)c(C)c1C(N)=O |
| InChI | InChI=1S/C18H21N3O4S2/c1-10-11(2)27-17(14(10)15(19)22)21-18(26)20-16(23)12-6-4-5-7-13(12)25-9-8-24-3/h4-7H,8-9H2,1-3H3,(H2,19,22)(H2,20,21,23,26) |
| InChIKey | PJWBQDLTWPBDOC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|