C17H12FNO3S2 — CID 16644350
methyl 2-[(2-fluorobenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 16644350) has the molecular formula C17H12FNO3S2 and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 2-[(2-fluorobenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-fluorobenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 16644350 |
| Molecular Formula | C17H12FNO3S2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | methyl 2-[(2-fluorobenzoyl)amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccs2)csc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H12FNO3S2/c1-22-17(21)14-11(13-7-4-8-23-13)9-24-16(14)19-15(20)10-5-2-3-6-12(10)18/h2-9H,1H3,(H,19,20) |
| InChIKey | SACNVEJGHDVKSZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|