C15H15NO4S2 — CID 143507717
2-(6-oxohexanoylamino)-4-thiophen-2-ylthiophene-3-carboxylic acid (PubChem CID 143507717) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-(6-oxohexanoylamino)-4-thiophen-2-ylthiophene-3-carboxylic acid.
| Compound Name | 2-(6-oxohexanoylamino)-4-thiophen-2-ylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143507717 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-(6-oxohexanoylamino)-4-thiophen-2-ylthiophene-3-carboxylic acid |
| SMILES | O=CCCCCC(=O)Nc1scc(-c2cccs2)c1C(=O)O |
| InChI | InChI=1S/C15H15NO4S2/c17-7-3-1-2-6-12(18)16-14-13(15(19)20)10(9-22-14)11-5-4-8-21-11/h4-5,7-9H,1-3,6H2,(H,16,18)(H,19,20) |
| InChIKey | GPIHBOLYICMEHU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|