C13H15NO2S2 — CID 82056962
2-methylpropyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 82056962) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-methylpropyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | 2-methylpropyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 82056962 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-methylpropyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CC(C)COC(=O)c1c(-c2cccs2)csc1N |
| InChI | InChI=1S/C13H15NO2S2/c1-8(2)6-16-13(15)11-9(7-18-12(11)14)10-4-3-5-17-10/h3-5,7-8H,6,14H2,1-2H3 |
| InChIKey | STZMESBCLIYUNO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |