C29H35N3O6S — CID 110502917
methyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]-5-methylthiophene-3-carboxylate (PubChem CID 110502917) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is methyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 110502917 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | methyl 2-[(3-amino-4-propoxybenzoyl)amino]-4-[4-[2-(diethylamino)-2-oxoethoxy]phenyl]-5-methylthiophene-3-carboxylate |
| SMILES | CCCOc1ccc(C(=O)Nc2sc(C)c(-c3ccc(OCC(=O)N(CC)CC)cc3)c2C(=O)OC)cc1N |
| InChI | InChI=1S/C29H35N3O6S/c1-6-15-37-23-14-11-20(16-22(23)30)27(34)31-28-26(29(35)36-5)25(18(4)39-28)19-9-12-21(13-10-19)38-17-24(33)32(7-2)8-3/h9-14,16H,6-8,15,17,30H2,1-5H3,(H,31,34) |
| InChIKey | VIXGDVCUVYFUBK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|