C18H22N2O4 — CID 110499819
3-amino-N-(2,4-dimethoxyphenyl)-4-propoxybenzamide (PubChem CID 110499819) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethoxyphenyl)-4-propoxybenzamide.
| Compound Name | 3-amino-N-(2,4-dimethoxyphenyl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 110499819 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-amino-N-(2,4-dimethoxyphenyl)-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2ccc(OC)cc2OC)cc1N |
| InChI | InChI=1S/C18H22N2O4/c1-4-9-24-16-8-5-12(10-14(16)19)18(21)20-15-7-6-13(22-2)11-17(15)23-3/h5-8,10-11H,4,9,19H2,1-3H3,(H,20,21) |
| InChIKey | KTCJXKBBVHNQLC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|