C20H24N2O6S — CID 110502925
diethyl 2-[(3-amino-4-propoxybenzoyl)amino]thiophene-3,4-dicarboxylate (PubChem CID 110502925) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is diethyl 2-[(3-amino-4-propoxybenzoyl)amino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(3-amino-4-propoxybenzoyl)amino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 110502925 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | diethyl 2-[(3-amino-4-propoxybenzoyl)amino]thiophene-3,4-dicarboxylate |
| SMILES | CCCOc1ccc(C(=O)Nc2scc(C(=O)OCC)c2C(=O)OCC)cc1N |
| InChI | InChI=1S/C20H24N2O6S/c1-4-9-28-15-8-7-12(10-14(15)21)17(23)22-18-16(20(25)27-6-3)13(11-29-18)19(24)26-5-2/h7-8,10-11H,4-6,9,21H2,1-3H3,(H,22,23) |
| InChIKey | ARJHUWVZAHENIU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|