C17H17N3O2S2 — CID 110502865
3-amino-4-propoxy-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 110502865) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 3-amino-4-propoxy-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-amino-4-propoxy-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 110502865 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 3-amino-4-propoxy-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2nc(-c3cccs3)cs2)cc1N |
| InChI | InChI=1S/C17H17N3O2S2/c1-2-7-22-14-6-5-11(9-12(14)18)16(21)20-17-19-13(10-24-17)15-4-3-8-23-15/h3-6,8-10H,2,7,18H2,1H3,(H,19,20,21) |
| InChIKey | LEWMMVYPURFJRC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|