C22H19N5O3S2 — CID 2132647
methyl 5-methyl-4-phenyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 2132647) has the molecular formula C22H19N5O3S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is methyl 5-methyl-4-phenyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-4-phenyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2132647 |
| Molecular Formula | C22H19N5O3S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | methyl 5-methyl-4-phenyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2nnnn2-c2ccccc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H19N5O3S2/c1-14-18(15-9-5-3-6-10-15)19(21(29)30-2)20(32-14)23-17(28)13-31-22-24-25-26-27(22)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3,(H,23,28) |
| InChIKey | XCRUMISJYVGJHN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|