C19H17N3O3S2 — CID 17379565
methyl 5-methyl-4-phenyl-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 17379565) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is methyl 5-methyl-4-phenyl-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-4-phenyl-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17379565 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | methyl 5-methyl-4-phenyl-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2ncccn2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3S2/c1-12-15(13-7-4-3-5-8-13)16(18(24)25-2)17(27-12)22-14(23)11-26-19-20-9-6-10-21-19/h3-10H,11H2,1-2H3,(H,22,23) |
| InChIKey | AUNKGKFMHJUSCT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|