C29H30N4O3S2 — CID 17303179
methyl 5-methyl-4-phenyl-2-[[2-[[5-(4-propan-2-ylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 17303179) has the molecular formula C29H30N4O3S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is methyl 5-methyl-4-phenyl-2-[[2-[[5-(4-propan-2-ylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-4-phenyl-2-[[2-[[5-(4-propan-2-ylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17303179 |
| Molecular Formula | C29H30N4O3S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | methyl 5-methyl-4-phenyl-2-[[2-[[5-(4-propan-2-ylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc(C)c(-c3ccccc3)c2C(=O)OC)nnc1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H30N4O3S2/c1-6-16-33-26(22-14-12-20(13-15-22)18(2)3)31-32-29(33)37-17-23(34)30-27-25(28(35)36-5)24(19(4)38-27)21-10-8-7-9-11-21/h6-15,18H,1,16-17H2,2-5H3,(H,30,34) |
| InChIKey | YHYXWVZBRKLUGS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|