C25H30N4O4S2 — CID 19732736
methyl 2-[[2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 19732736) has the molecular formula C25H30N4O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19732736 |
| Molecular Formula | C25H30N4O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 2-[[2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc(C)c(C)c2C(=O)OC)nnc1-c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C25H30N4O4S2/c1-6-8-14-33-19-11-9-18(10-12-19)22-27-28-25(29(22)13-7-2)34-15-20(30)26-23-21(24(31)32-5)16(3)17(4)35-23/h7,9-12H,2,6,8,13-15H2,1,3-5H3,(H,26,30) |
| InChIKey | XTFCESMXFUWYJW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|