C9H11NO3S — CID 2385893
ethyl 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carboxylate (PubChem CID 2385893) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is ethyl 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2385893 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | ethyl 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc(=O)[nH]c1S |
| InChI | InChI=1S/C9H11NO3S/c1-3-13-9(12)7-5(2)4-6(11)10-8(7)14/h4H,3H2,1-2H3,(H2,10,11,14) |
| InChIKey | QBHXZOGOLDECTI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|