C9H11NO4 — CID 82399157
2-(methoxymethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 82399157) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 2-(methoxymethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82399157 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(methoxymethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | COCc1[nH]c(=O)cc(C)c1C(=O)O |
| InChI | InChI=1S/C9H11NO4/c1-5-3-7(11)10-6(4-14-2)8(5)9(12)13/h3H,4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | PNWLUJIQAJNVIX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |