C8H9NO3 — CID 3446564
2,4-dimethyl-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 3446564) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2,4-dimethyl-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 2,4-dimethyl-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 3446564 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2,4-dimethyl-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | Cc1cc(=O)[nH]c(C)c1C(=O)O |
| InChI | InChI=1S/C8H9NO3/c1-4-3-6(10)9-5(2)7(4)8(11)12/h3H,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | KEUKIIMPYLKESR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |